C19H21NO4 — CID 54056990
(1,3-dioxo-4,7-dihydroisoindol-2-yl)methyl 3-buta-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54056990) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1,3-dioxo-4,7-dihydroisoindol-2-yl)methyl 3-buta-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (1,3-dioxo-4,7-dihydroisoindol-2-yl)methyl 3-buta-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54056990 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (1,3-dioxo-4,7-dihydroisoindol-2-yl)methyl 3-buta-1,3-dienyl-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=CC=CC1C(C(=O)OCN2C(=O)C3=C(CC=CC3)C2=O)C1(C)C |
| InChI | InChI=1S/C19H21NO4/c1-4-5-10-14-15(19(14,2)3)18(23)24-11-20-16(21)12-8-6-7-9-13(12)17(20)22/h4-7,10,14-15H,1,8-9,11H2,2-3H3 |
| InChIKey | LWYFJWYSFCQCDD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|