About 1-benzylpyrrole-2,5-diol
1-benzylpyrrole-2,5-diol (PubChem CID 54057101) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-benzylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-benzylpyrrole-2,5-diol |
| PubChem CID | 54057101 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-benzylpyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1Cc1ccccc1 |
| InChI | InChI=1S/C11H11NO2/c13-10-6-7-11(14)12(10)8-9-4-2-1-3-5-9/h1-7,13-14H,8H2 |
| InChIKey | LXACCZJGJWCJJF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrrole-2,5-diol?
The IUPAC name of 1-benzylpyrrole-2,5-diol (CID 54057101) is 1-benzylpyrrole-2,5-diol.
What is the SMILES notation for 1-benzylpyrrole-2,5-diol?
The canonical SMILES for 1-benzylpyrrole-2,5-diol is Oc1ccc(O)n1Cc1ccccc1.
What is the InChIKey of 1-benzylpyrrole-2,5-diol?
The InChIKey is LXACCZJGJWCJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c13-10-6-7-11(14)12(10)8-9-4-2-1-3-5-9/h1-7,13-14H,8H2.
What are the key properties of 1-benzylpyrrole-2,5-diol?
1-benzylpyrrole-2,5-diol has a molecular weight of 189.21 g/mol, XLogP of 1.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrrole-2,5-diol is sourced from PubChem (CID 54057101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).