About 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione
5,6-dichlorobenzo[e][2]benzofuran-1,3-dione (PubChem CID 54057526) has the molecular formula C12H4Cl2O3
and a molecular weight of 267.07 g/mol. Its IUPAC name is 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione |
| PubChem CID | 54057526 |
| Molecular Formula | C12H4Cl2O3 |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.95 |
| IUPAC Name | 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1cc(Cl)c1c(Cl)cccc21 |
| InChI | InChI=1S/C12H4Cl2O3/c13-7-3-1-2-5-9-6(4-8(14)10(5)7)11(15)17-12(9)16/h1-4H |
| InChIKey | LXHUYLMYICHHHY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione?
The IUPAC name of 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione (CID 54057526) is 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione.
What is the SMILES notation for 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione?
The canonical SMILES for 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione is O=C1OC(=O)c2c1cc(Cl)c1c(Cl)cccc21.
What is the InChIKey of 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione?
The InChIKey is LXHUYLMYICHHHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl2O3/c13-7-3-1-2-5-9-6(4-8(14)10(5)7)11(15)17-12(9)16/h1-4H.
What are the key properties of 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione?
5,6-dichlorobenzo[e][2]benzofuran-1,3-dione has a molecular weight of 267.07 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichlorobenzo[e][2]benzofuran-1,3-dione is sourced from PubChem (CID 54057526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).