C11H12N2O3 — CID 54057715
1-ethyl-6,7-dimethylpyrido[2,3-d][1,3]oxazine-2,4-dione (PubChem CID 54057715) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-ethyl-6,7-dimethylpyrido[2,3-d][1,3]oxazine-2,4-dione.
| Compound Name | 1-ethyl-6,7-dimethylpyrido[2,3-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 54057715 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-ethyl-6,7-dimethylpyrido[2,3-d][1,3]oxazine-2,4-dione |
| SMILES | CCn1c(=O)oc(=O)c2cc(C)c(C)nc21 |
| InChI | InChI=1S/C11H12N2O3/c1-4-13-9-8(10(14)16-11(13)15)5-6(2)7(3)12-9/h5H,4H2,1-3H3 |
| InChIKey | LXLCYJSLKFAFRD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |