About 3-methanimidoylpentanoic acid
3-methanimidoylpentanoic acid (PubChem CID 54057886) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 3-methanimidoylpentanoic acid.
Molecular Properties
| Compound Name | 3-methanimidoylpentanoic acid |
| PubChem CID | 54057886 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 3-methanimidoylpentanoic acid |
| SMILES | [H]/N=C/C(CC)CC(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-2-5(4-7)3-6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9)/b7-4+ |
| InChIKey | LXOCJGPNNYEOFF-QPJJXVBHSA-N |
| XLogP | 1.14 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methanimidoylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methanimidoylpentanoic acid?
The IUPAC name of 3-methanimidoylpentanoic acid (CID 54057886) is 3-methanimidoylpentanoic acid.
What is the SMILES notation for 3-methanimidoylpentanoic acid?
The canonical SMILES for 3-methanimidoylpentanoic acid is [H]/N=C/C(CC)CC(=O)O.
What is the InChIKey of 3-methanimidoylpentanoic acid?
The InChIKey is LXOCJGPNNYEOFF-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-5(4-7)3-6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9)/b7-4+.
What are the key properties of 3-methanimidoylpentanoic acid?
3-methanimidoylpentanoic acid has a molecular weight of 129.16 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanimidoylpentanoic acid is sourced from PubChem (CID 54057886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).