3-methanimidoylpentanoic acid

C6H11NO2 — CID 54057886

IUPAC3-methanimidoylpentanoic acid
SMILES[H]/N=C/C(CC)CC(=O)O
InChIInChI=1S/C6H11NO2/c1-2-5(4-7)3-6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9)/b7-4+
InChIKeyLXOCJGPNNYEOFF-QPJJXVBHSA-N
MW129.16 g/mol
LogP1.14
Rot. Bonds4

About 3-methanimidoylpentanoic acid

3-methanimidoylpentanoic acid (PubChem CID 54057886) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 3-methanimidoylpentanoic acid.

Molecular Properties

Compound Name3-methanimidoylpentanoic acid
PubChem CID54057886
Molecular FormulaC6H11NO2
Molecular Weight129.16 g/mol
Exact Mass129.08
IUPAC Name3-methanimidoylpentanoic acid
SMILES[H]/N=C/C(CC)CC(=O)O
InChIInChI=1S/C6H11NO2/c1-2-5(4-7)3-6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9)/b7-4+
InChIKeyLXOCJGPNNYEOFF-QPJJXVBHSA-N
XLogP1.14
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500129.16
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 3-methanimidoylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methanimidoylpentanoic acid?
The IUPAC name of 3-methanimidoylpentanoic acid (CID 54057886) is 3-methanimidoylpentanoic acid.
What is the SMILES notation for 3-methanimidoylpentanoic acid?
The canonical SMILES for 3-methanimidoylpentanoic acid is [H]/N=C/C(CC)CC(=O)O.
What is the InChIKey of 3-methanimidoylpentanoic acid?
The InChIKey is LXOCJGPNNYEOFF-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-5(4-7)3-6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9)/b7-4+.
What are the key properties of 3-methanimidoylpentanoic acid?
3-methanimidoylpentanoic acid has a molecular weight of 129.16 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methanimidoylpentanoic acid is sourced from PubChem (CID 54057886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).