About 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine
2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine (PubChem CID 54058444) has the molecular formula C25H37NO
and a molecular weight of 367.58 g/mol. Its IUPAC name is 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine.
Molecular Properties
| Compound Name | 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine |
| PubChem CID | 54058444 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine |
| SMILES | CCc1c(C(C)(C)N)cc(CC(C)C)c(CC(C)C)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H37NO/c1-8-21-23(25(6,7)26)16-19(14-17(2)3)22(15-18(4)5)24(21)27-20-12-10-9-11-13-20/h9-13,16-18H,8,14-15,26H2,1-7H3 |
| InChIKey | LXYAXEAYHOULMG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine?
The IUPAC name of 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine (CID 54058444) is 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine.
What is the SMILES notation for 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine?
The canonical SMILES for 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine is CCc1c(C(C)(C)N)cc(CC(C)C)c(CC(C)C)c1Oc1ccccc1.
What is the InChIKey of 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine?
The InChIKey is LXYAXEAYHOULMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37NO/c1-8-21-23(25(6,7)26)16-19(14-17(2)3)22(15-18(4)5)24(21)27-20-12-10-9-11-13-20/h9-13,16-18H,8,14-15,26H2,1-7H3.
What are the key properties of 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine?
2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine has a molecular weight of 367.58 g/mol, XLogP of 6.63, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-ethyl-4,5-bis(2-methylpropyl)-3-phenoxyphenyl]propan-2-amine is sourced from PubChem (CID 54058444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).