C17H16F5NO6 — CID 54059017
tert-butyl 2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxobutanoate (PubChem CID 54059017) has the molecular formula C17H16F5NO6 and a molecular weight of 425.31 g/mol. Its IUPAC name is tert-butyl 2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxobutanoate.
| Compound Name | tert-butyl 2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 54059017 |
| Molecular Formula | C17H16F5NO6 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | tert-butyl 2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxobutanoate |
| SMILES | CC(=O)C(C(=O)OC(C)(C)C)C(=O)c1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F5NO6/c1-8(24)12(14(26)29-15(2,3)4)13(25)10-6-5-9(7-11(10)23(27)28)16(18,19)17(20,21)22/h5-7,12H,1-4H3 |
| InChIKey | LYHZRVARDWVOJO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|