C13H20O4 — CID 54059124
6-[(1S,2S,3S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid (PubChem CID 54059124) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-[(1S,2S,3S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid.
| Compound Name | 6-[(1S,2S,3S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 54059124 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-[(1S,2S,3S,4R)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CC[C@H]1[C@@H](CO)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C13H20O4/c14-8-10-9(11-6-7-12(10)17-11)4-2-1-3-5-13(15)16/h1-2,9-12,14H,3-8H2,(H,15,16)/t9-,10+,11-,12+/m0/s1 |
| InChIKey | LYJXHGUQEKVVDF-WHOHXGKFSA-N |
| XLogP | 1.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|