C12H18F3NO4S — CID 54059189
(2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-methylpentanoic acid (PubChem CID 54059189) has the molecular formula C12H18F3NO4S and a molecular weight of 329.34 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 54059189 |
| Molecular Formula | C12H18F3NO4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(=O)SCC(C(=O)N[C@@H](CC(C)C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO4S/c1-6(2)4-9(11(19)20)16-10(18)8(12(13,14)15)5-21-7(3)17/h6,8-9H,4-5H2,1-3H3,(H,16,18)(H,19,20)/t8?,9-/m0/s1 |
| InChIKey | LYLFLQIEBIJQAP-GKAPJAKFSA-N |
| XLogP | 2.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|