About (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate
(2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate (PubChem CID 54059386) has the molecular formula C11H10N2O4
and a molecular weight of 234.21 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate |
| PubChem CID | 54059386 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C11H10N2O4/c12-8-3-1-7(2-4-8)11(16)17-13-9(14)5-6-10(13)15/h1-6,14-15H,12H2 |
| InChIKey | LYOPOQAQKFOWEJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate (CID 54059386) is (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate is Nc1ccc(C(=O)On2c(O)ccc2O)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate?
The InChIKey is LYOPOQAQKFOWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4/c12-8-3-1-7(2-4-8)11(16)17-13-9(14)5-6-10(13)15/h1-6,14-15H,12H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate?
(2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate has a molecular weight of 234.21 g/mol, XLogP of 0.75, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4-aminobenzoate is sourced from PubChem (CID 54059386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).