About (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate
(2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 54059607) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| PubChem CID | 54059607 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)OCc1ccccc1)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C17H20N2O6/c1-11(2)15(16(22)25-19-13(20)8-9-14(19)21)18-17(23)24-10-12-6-4-3-5-7-12/h3-9,11,15,20-21H,10H2,1-2H3,(H,18,23)/t15-/m1/s1 |
| InChIKey | LYSOIRHYKHYURY-OAHLLOKOSA-N |
| XLogP | 1.81 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (CID 54059607) is (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate is CC(C)[C@@H](NC(=O)OCc1ccccc1)C(=O)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate?
The InChIKey is LYSOIRHYKHYURY-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H20N2O6/c1-11(2)15(16(22)25-19-13(20)8-9-14(19)21)18-17(23)24-10-12-6-4-3-5-7-12/h3-9,11,15,20-21H,10H2,1-2H3,(H,18,23)/t15-/m1/s1.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate?
(2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate has a molecular weight of 348.36 g/mol, XLogP of 1.81, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate is sourced from PubChem (CID 54059607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).