C10H20O6 — CID 54059741
(1R,2S,3R,4R)-1-(3-methyloxolan-2-yl)pentane-1,2,3,4,5-pentol (PubChem CID 54059741) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (1R,2S,3R,4R)-1-(3-methyloxolan-2-yl)pentane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,3R,4R)-1-(3-methyloxolan-2-yl)pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 54059741 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (1R,2S,3R,4R)-1-(3-methyloxolan-2-yl)pentane-1,2,3,4,5-pentol |
| SMILES | CC1CCOC1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O6/c1-5-2-3-16-10(5)9(15)8(14)7(13)6(12)4-11/h5-15H,2-4H2,1H3/t5?,6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | LYVBMRYTQNOAPE-VXIHOVOASA-N |
| XLogP | -2.15 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |