About cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid
cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid (PubChem CID 54059793) has the molecular formula C11H17F2NO4
and a molecular weight of 265.25 g/mol. Its IUPAC name is cis-(1R,2S)-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid |
| PubChem CID | 54059793 |
| Molecular Formula | C11H17F2NO4 |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | cis-(1R,2S)-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(C[C@H]1C(=O)O)(F)F |
| InChI | InChI=1S/C11H17F2NO4/c1-10(2,3)18-9(17)14-7-5-11(12,13)4-6(7)8(15)16/h6-7H,4-5H2,1-3H3,(H,14,17)(H,15,16)/t6-,7+/m1/s1 |
| InChIKey | LYWABOYEWJKFHC-RQJHMYQMSA-N |
| XLogP | 2.20 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 351 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid?
The IUPAC name of cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid (CID 54059793) is cis-(1R,2S)-4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid?
The canonical SMILES for cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid is CC(C)(C)OC(=O)N[C@H]1CC(C[C@H]1C(=O)O)(F)F.
What is the InChIKey of cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid?
The InChIKey is LYWABOYEWJKFHC-RQJHMYQMSA-N. The full InChI is InChI=1S/C11H17F2NO4/c1-10(2,3)18-9(17)14-7-5-11(12,13)4-6(7)8(15)16/h6-7H,4-5H2,1-3H3,(H,14,17)(H,15,16)/t6-,7+/m1/s1.
What are the key properties of cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid?
cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid has a molecular weight of 265.25 g/mol, XLogP of 2.20, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cis-2-((tert-Butoxycarbonyl)amino)-4,4-difluorocyclopentane-1-carboxylic acid is sourced from PubChem (CID 54059793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).