C19H14N2O4 — CID 54059907
methyl 3-(3-cyanophenyl)-5-(4-nitrophenyl)penta-2,4-dienoate (PubChem CID 54059907) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is methyl 3-(3-cyanophenyl)-5-(4-nitrophenyl)penta-2,4-dienoate.
| Compound Name | methyl 3-(3-cyanophenyl)-5-(4-nitrophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 54059907 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl 3-(3-cyanophenyl)-5-(4-nitrophenyl)penta-2,4-dienoate |
| SMILES | COC(=O)C=C(C=Cc1ccc([N+](=O)[O-])cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H14N2O4/c1-25-19(22)12-17(16-4-2-3-15(11-16)13-20)8-5-14-6-9-18(10-7-14)21(23)24/h2-12H,1H3 |
| InChIKey | LYYBBLIGHNTXHZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|