C20H36O — CID 54059993
1-[(1S,2S)-2-hepta-4,6-dienylcyclopentyl]octan-1-ol (PubChem CID 54059993) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-[(1S,2S)-2-hepta-4,6-dienylcyclopentyl]octan-1-ol.
| Compound Name | 1-[(1S,2S)-2-hepta-4,6-dienylcyclopentyl]octan-1-ol |
|---|---|
| PubChem CID | 54059993 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 1-[(1S,2S)-2-hepta-4,6-dienylcyclopentyl]octan-1-ol |
| SMILES | C=CC=CCCC[C@H]1CCC[C@@H]1C(O)CCCCCCC |
| InChI | InChI=1S/C20H36O/c1-3-5-7-9-11-14-18-15-13-16-19(18)20(21)17-12-10-8-6-4-2/h3,5,7,18-21H,1,4,6,8-17H2,2H3/t18-,19-,20?/m0/s1 |
| InChIKey | LYZSCISDEXQXSJ-NFBCFJMWSA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|