About (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate
(1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate (PubChem CID 54060243) has the molecular formula C23H34O2
and a molecular weight of 342.52 g/mol. Its IUPAC name is (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate.
Molecular Properties
| Compound Name | (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate |
| PubChem CID | 54060243 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate |
| SMILES | CCC1(OC(=O)C2CC3CC2CC32CC3CC2C(C)C3C)C=CCC1 |
| InChI | InChI=1S/C23H34O2/c1-4-22(7-5-6-8-22)25-21(24)19-11-18-9-17(19)13-23(18)12-16-10-20(23)15(3)14(16)2/h5,7,14-20H,4,6,8-13H2,1-3H3 |
| InChIKey | LZELPIVTFLXPAY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate?
The IUPAC name of (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate (CID 54060243) is (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate.
What is the SMILES notation for (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate?
The canonical SMILES for (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate is CCC1(OC(=O)C2CC3CC2CC32CC3CC2C(C)C3C)C=CCC1.
What is the InChIKey of (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate?
The InChIKey is LZELPIVTFLXPAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34O2/c1-4-22(7-5-6-8-22)25-21(24)19-11-18-9-17(19)13-23(18)12-16-10-20(23)15(3)14(16)2/h5,7,14-20H,4,6,8-13H2,1-3H3.
What are the key properties of (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate?
(1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate has a molecular weight of 342.52 g/mol, XLogP of 5.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopent-2-en-1-yl) 5,6-dimethyl-2,5'-spirobi[bicyclo[2.2.1]heptane]-2'-carboxylate is sourced from PubChem (CID 54060243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).