C11H19NO — CID 54060540
6-methoxy-1-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline (PubChem CID 54060540) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 6-methoxy-1-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline.
| Compound Name | 6-methoxy-1-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline |
|---|---|
| PubChem CID | 54060540 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 6-methoxy-1-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline |
| SMILES | COC1CC=C2C(CCNC2C)C1 |
| InChI | InChI=1S/C11H19NO/c1-8-11-4-3-10(13-2)7-9(11)5-6-12-8/h4,8-10,12H,3,5-7H2,1-2H3 |
| InChIKey | LZJRFKZADDLHKY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|