C29H41BrOSi — CID 54060703
[2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 54060703) has the molecular formula C29H41BrOSi and a molecular weight of 513.64 g/mol. Its IUPAC name is [2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 54060703 |
| Molecular Formula | C29H41BrOSi |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | [2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1(C)CCC(C)(C)c2cc(C=C(CO[Si](C)(C)C(C)(C)C)c3cccc(Br)c3)ccc21 |
| InChI | InChI=1S/C29H41BrOSi/c1-27(2,3)32(8,9)31-20-23(22-11-10-12-24(30)19-22)17-21-13-14-25-26(18-21)29(6,7)16-15-28(25,4)5/h10-14,17-19H,15-16,20H2,1-9H3 |
| InChIKey | LZMGQSGOBMHXMK-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|