About 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide
3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide (PubChem CID 54061101) has the molecular formula C19H14Cl2N2O
and a molecular weight of 357.24 g/mol. Its IUPAC name is 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide.
Molecular Properties
| Compound Name | 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide |
| PubChem CID | 54061101 |
| Molecular Formula | C19H14Cl2N2O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide |
| SMILES | CN(C(=O)C=Cc1c(Cl)ccc2cc(Cl)cnc12)c1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2O/c1-23(15-5-3-2-4-6-15)18(24)10-8-16-17(21)9-7-13-11-14(20)12-22-19(13)16/h2-12H,1H3 |
| InChIKey | LZTHWISKDHIRRZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide?
The IUPAC name of 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide (CID 54061101) is 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide.
What is the SMILES notation for 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide?
The canonical SMILES for 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide is CN(C(=O)C=Cc1c(Cl)ccc2cc(Cl)cnc12)c1ccccc1.
What is the InChIKey of 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide?
The InChIKey is LZTHWISKDHIRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N2O/c1-23(15-5-3-2-4-6-15)18(24)10-8-16-17(21)9-7-13-11-14(20)12-22-19(13)16/h2-12H,1H3.
What are the key properties of 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide?
3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide has a molecular weight of 357.24 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,7-dichloroquinolin-8-yl)-N-methyl-N-phenylprop-2-enamide is sourced from PubChem (CID 54061101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).