About 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine
2-(1,3,5-triazin-2-yl)-1,3-oxazolidine (PubChem CID 54061386) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine |
| PubChem CID | 54061386 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine |
| SMILES | c1ncnc(C2NCCO2)n1 |
| InChI | InChI=1S/C6H8N4O/c1-2-11-6(8-1)5-9-3-7-4-10-5/h3-4,6,8H,1-2H2 |
| InChIKey | LZYRGKLXJVQOKU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine?
The IUPAC name of 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine (CID 54061386) is 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine.
What is the SMILES notation for 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine?
The canonical SMILES for 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine is c1ncnc(C2NCCO2)n1.
What is the InChIKey of 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine?
The InChIKey is LZYRGKLXJVQOKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c1-2-11-6(8-1)5-9-3-7-4-10-5/h3-4,6,8H,1-2H2.
What are the key properties of 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine?
2-(1,3,5-triazin-2-yl)-1,3-oxazolidine has a molecular weight of 152.16 g/mol, XLogP of -0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,5-triazin-2-yl)-1,3-oxazolidine is sourced from PubChem (CID 54061386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).