About octadeca-6,9,12-trienoyl chloride
octadeca-6,9,12-trienoyl chloride (PubChem CID 54061486) has the molecular formula C18H29ClO
and a molecular weight of 296.88 g/mol. Its IUPAC name is octadeca-6,9,12-trienoyl chloride.
Molecular Properties
| Compound Name | octadeca-6,9,12-trienoyl chloride |
| PubChem CID | 54061486 |
| Molecular Formula | C18H29ClO |
| Molecular Weight | 296.88 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | octadeca-6,9,12-trienoyl chloride |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)Cl |
| InChI | InChI=1S/C18H29ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10,12-13H,2-5,8,11,14-17H2,1H3 |
| InChIKey | MAAVGFJWXMUHAT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.88 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadeca-6,9,12-trienoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadeca-6,9,12-trienoyl chloride?
The IUPAC name of octadeca-6,9,12-trienoyl chloride (CID 54061486) is octadeca-6,9,12-trienoyl chloride.
What is the SMILES notation for octadeca-6,9,12-trienoyl chloride?
The canonical SMILES for octadeca-6,9,12-trienoyl chloride is CCCCCC=CCC=CCC=CCCCCC(=O)Cl.
What is the InChIKey of octadeca-6,9,12-trienoyl chloride?
The InChIKey is MAAVGFJWXMUHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29ClO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10,12-13H,2-5,8,11,14-17H2,1H3.
What are the key properties of octadeca-6,9,12-trienoyl chloride?
octadeca-6,9,12-trienoyl chloride has a molecular weight of 296.88 g/mol, XLogP of 6.34, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadeca-6,9,12-trienoyl chloride is sourced from PubChem (CID 54061486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).