About 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid
1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 5406157) has the molecular formula C13H10N2O2
and a molecular weight of 226.24 g/mol. Its IUPAC name is 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| PubChem CID | 5406157 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H10N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-6,15H,1H3,(H,16,17) |
| InChIKey | MFEZJNMQTQMDRQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The IUPAC name of 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (CID 5406157) is 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid.
What is the SMILES notation for 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The canonical SMILES for 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid is Cc1nc(C(=O)O)cc2c1[nH]c1ccccc12.
What is the InChIKey of 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The InChIKey is MFEZJNMQTQMDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-6,15H,1H3,(H,16,17).
What are the key properties of 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid has a molecular weight of 226.24 g/mol, XLogP of 2.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-9H-pyrido[3,4-b]indole-3-carboxylic acid is sourced from PubChem (CID 5406157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).