C29H50O4Si2 — CID 54061951
(8R,9S,10S,13S,14S)-10-(2-methoxyethoxymethoxymethyl)-13-methyl-3,17-bis(trimethylsilyl)-1,3,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-2-one (PubChem CID 54061951) has the molecular formula C29H50O4Si2 and a molecular weight of 518.89 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10-(2-methoxyethoxymethoxymethyl)-13-methyl-3,17-bis(trimethylsilyl)-1,3,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-2-one.
| Compound Name | (8R,9S,10S,13S,14S)-10-(2-methoxyethoxymethoxymethyl)-13-methyl-3,17-bis(trimethylsilyl)-1,3,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-2-one |
|---|---|
| PubChem CID | 54061951 |
| Molecular Formula | C29H50O4Si2 |
| Molecular Weight | 518.89 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10-(2-methoxyethoxymethoxymethyl)-13-methyl-3,17-bis(trimethylsilyl)-1,3,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-2-one |
| SMILES | COCCOCOC[C@]12CC(=O)C([Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C([Si](C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C29H50O4Si2/c1-28-14-13-24-22(23(28)11-12-27(28)35(6,7)8)10-9-21-17-26(34(3,4)5)25(30)18-29(21,24)19-33-20-32-16-15-31-2/h12,17,22-24,26H,9-11,13-16,18-20H2,1-8H3/t22-,23-,24-,26?,28-,29+/m0/s1 |
| InChIKey | MAILMBAVTPDTRB-YJDFQNIWSA-N |
| XLogP | 6.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.89 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|