About (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid
(1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 54062585) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid |
| PubChem CID | 54062585 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CON=C1[C@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C7H11NO3/c1-7(2)4(6(9)10)5(7)8-11-3/h4H,1-3H3,(H,9,10)/t4-/m1/s1 |
| InChIKey | MATWATSXMHCZSG-SCSAIBSYSA-N |
| XLogP | 0.73 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid?
The IUPAC name of (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid (CID 54062585) is (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid.
What is the SMILES notation for (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid?
The canonical SMILES for (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid is CON=C1[C@H](C(=O)O)C1(C)C.
What is the InChIKey of (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid?
The InChIKey is MATWATSXMHCZSG-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-7(2)4(6(9)10)5(7)8-11-3/h4H,1-3H3,(H,9,10)/t4-/m1/s1.
What are the key properties of (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid?
(1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-methoxyimino-2,2-dimethylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 54062585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).