C10H17FO7 — CID 54062775
cis-methyl (1S,2S)-2-[(1R,2R)-3-fluoro-1,2,3-trihydroxypropyl]-1,2-dihydroxy-3,3-dimethylcyclopropane-1-carboxylate (PubChem CID 54062775) has the molecular formula C10H17FO7 and a molecular weight of 268.24 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-[(1R,2R)-3-fluoro-1,2,3-trihydroxypropyl]-1,2-dihydroxy-3,3-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2S)-2-[(1R,2R)-3-fluoro-1,2,3-trihydroxypropyl]-1,2-dihydroxy-3,3-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54062775 |
| Molecular Formula | C10H17FO7 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | cis-methyl (1S,2S)-2-[(1R,2R)-3-fluoro-1,2,3-trihydroxypropyl]-1,2-dihydroxy-3,3-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)C(C)(C)[C@]1(O)[C@H](O)[C@@H](O)C(O)F |
| InChI | InChI=1S/C10H17FO7/c1-8(2)9(16,5(13)4(12)6(11)14)10(8,17)7(15)18-3/h4-6,12-14,16-17H,1-3H3/t4-,5-,6?,9-,10+/m1/s1 |
| InChIKey | MAWYNTXWINBYRA-AJSCWSMRSA-N |
| XLogP | -2.33 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |