About (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide
(2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide (PubChem CID 54064047) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide.
Molecular Properties
| Compound Name | (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide |
| PubChem CID | 54064047 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide |
| SMILES | C=C(C)/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C8H13NO2/c1-7(2)5-6-8(10)9(3)11-4/h5-6H,1H2,2-4H3/b6-5+ |
| InChIKey | MBSJBDUBXVHPDA-AATRIKPKSA-N |
| XLogP | 1.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide?
The IUPAC name of (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide (CID 54064047) is (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide.
What is the SMILES notation for (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide?
The canonical SMILES for (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide is C=C(C)/C=C/C(=O)N(C)OC.
What is the InChIKey of (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide?
The InChIKey is MBSJBDUBXVHPDA-AATRIKPKSA-N. The full InChI is InChI=1S/C8H13NO2/c1-7(2)5-6-8(10)9(3)11-4/h5-6H,1H2,2-4H3/b6-5+.
What are the key properties of (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide?
(2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide has a molecular weight of 155.20 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-methoxy-N,4-dimethylpenta-2,4-dienamide is sourced from PubChem (CID 54064047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).