C24H46N2O2 — CID 54064102
N-[2-(dimethylamino)ethyl]-7-[(1R,2R,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanamide (PubChem CID 54064102) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-7-[(1R,2R,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-7-[(1R,2R,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanamide |
|---|---|
| PubChem CID | 54064102 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-7-[(1R,2R,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanamide |
| SMILES | CCCCCCC=C[C@H]1CC[C@@H](O)[C@@H]1CCCCCCC(=O)NCCN(C)C |
| InChI | InChI=1S/C24H46N2O2/c1-4-5-6-7-8-11-14-21-17-18-23(27)22(21)15-12-9-10-13-16-24(28)25-19-20-26(2)3/h11,14,21-23,27H,4-10,12-13,15-20H2,1-3H3,(H,25,28)/t21-,22+,23+/m0/s1 |
| InChIKey | MBSZYALSUJVKMG-YTFSRNRJSA-N |
| XLogP | 4.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|