About 2-sulfonyl-4a,5-dihydro-1H-naphthalene
2-sulfonyl-4a,5-dihydro-1H-naphthalene (PubChem CID 54064259) has the molecular formula C10H10O2S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-sulfonyl-4a,5-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 2-sulfonyl-4a,5-dihydro-1H-naphthalene |
| PubChem CID | 54064259 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-sulfonyl-4a,5-dihydro-1H-naphthalene |
| SMILES | O=S(=O)=C1C=CC2CC=CC=C2C1 |
| InChI | InChI=1S/C10H10O2S/c11-13(12)10-6-5-8-3-1-2-4-9(8)7-10/h1-2,4-6,8H,3,7H2 |
| InChIKey | AZYFXTQQHNMYSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonyl-4a,5-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonyl-4a,5-dihydro-1H-naphthalene?
The IUPAC name of 2-sulfonyl-4a,5-dihydro-1H-naphthalene (CID 54064259) is 2-sulfonyl-4a,5-dihydro-1H-naphthalene.
What is the SMILES notation for 2-sulfonyl-4a,5-dihydro-1H-naphthalene?
The canonical SMILES for 2-sulfonyl-4a,5-dihydro-1H-naphthalene is O=S(=O)=C1C=CC2CC=CC=C2C1.
What is the InChIKey of 2-sulfonyl-4a,5-dihydro-1H-naphthalene?
The InChIKey is AZYFXTQQHNMYSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S/c11-13(12)10-6-5-8-3-1-2-4-9(8)7-10/h1-2,4-6,8H,3,7H2.
What are the key properties of 2-sulfonyl-4a,5-dihydro-1H-naphthalene?
2-sulfonyl-4a,5-dihydro-1H-naphthalene has a molecular weight of 194.26 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonyl-4a,5-dihydro-1H-naphthalene is sourced from PubChem (CID 54064259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).