C13H14N2O2 — CID 54064271
9-amino-1,2,3,4-tetrahydroacridine-3,4-diol (PubChem CID 54064271) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 9-amino-1,2,3,4-tetrahydroacridine-3,4-diol.
| Compound Name | 9-amino-1,2,3,4-tetrahydroacridine-3,4-diol |
|---|---|
| PubChem CID | 54064271 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 9-amino-1,2,3,4-tetrahydroacridine-3,4-diol |
| SMILES | Nc1c2c(nc3ccccc13)C(O)C(O)CC2 |
| InChI | InChI=1S/C13H14N2O2/c14-11-7-3-1-2-4-9(7)15-12-8(11)5-6-10(16)13(12)17/h1-4,10,13,16-17H,5-6H2,(H2,14,15) |
| InChIKey | MBVVXMPTCOOITO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |