C58H79NO9 — CID 54064407
[(2R,3S,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-phenylmethoxy-5-[[(3R)-9-phenyl-3-(9-phenylnonanoyloxy)nonanoyl]amino]oxan-4-yl] 9-phenylnonanoate (PubChem CID 54064407) has the molecular formula C58H79NO9 and a molecular weight of 934.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-phenylmethoxy-5-[[(3R)-9-phenyl-3-(9-phenylnonanoyloxy)nonanoyl]amino]oxan-4-yl] 9-phenylnonanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-phenylmethoxy-5-[[(3R)-9-phenyl-3-(9-phenylnonanoyloxy)nonanoyl]amino]oxan-4-yl] 9-phenylnonanoate |
|---|---|
| PubChem CID | 54064407 |
| Molecular Formula | C58H79NO9 |
| Molecular Weight | 934.27 g/mol |
| Exact Mass | 933.58 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3-hydroxy-2-(hydroxymethyl)-6-phenylmethoxy-5-[[(3R)-9-phenyl-3-(9-phenylnonanoyloxy)nonanoyl]amino]oxan-4-yl] 9-phenylnonanoate |
| SMILES | O=C(C[C@@H](CCCCCCc1ccccc1)OC(=O)CCCCCCCCc1ccccc1)N[C@H]1[C@H](OCc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1OC(=O)CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C58H79NO9/c60-44-51-56(64)57(68-54(63)42-28-8-4-2-6-16-30-47-34-20-12-21-35-47)55(58(67-51)65-45-49-38-24-14-25-39-49)59-52(61)43-50(40-26-10-9-17-31-48-36-22-13-23-37-48)66-53(62)41-27-7-3-1-5-15-29-46-32-18-11-19-33-46/h11-14,18-25,32-39,50-51,55-58,60,64H,1-10,15-17,26-31,40-45H2,(H,59,61)/t50-,51-,55-,56-,57-,58-/m1/s1 |
| InChIKey | MBYCORHLIIEUTO-UKMBMDMOSA-N |
| XLogP | 11.12 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.27 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|