About 6-sulfonylhexanal
6-sulfonylhexanal (PubChem CID 54064815) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 6-sulfonylhexanal.
Molecular Properties
| Compound Name | 6-sulfonylhexanal |
| PubChem CID | 54064815 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 6-sulfonylhexanal |
| SMILES | O=CCCCCC=S(=O)=O |
| InChI | InChI=1S/C6H10O3S/c7-5-3-1-2-4-6-10(8)9/h5-6H,1-4H2 |
| InChIKey | YCBQPTHDXBFTSV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfonylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfonylhexanal?
The IUPAC name of 6-sulfonylhexanal (CID 54064815) is 6-sulfonylhexanal.
What is the SMILES notation for 6-sulfonylhexanal?
The canonical SMILES for 6-sulfonylhexanal is O=CCCCCC=S(=O)=O.
What is the InChIKey of 6-sulfonylhexanal?
The InChIKey is YCBQPTHDXBFTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c7-5-3-1-2-4-6-10(8)9/h5-6H,1-4H2.
What are the key properties of 6-sulfonylhexanal?
6-sulfonylhexanal has a molecular weight of 162.21 g/mol, XLogP of 0.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfonylhexanal is sourced from PubChem (CID 54064815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).