C12H12Cl6N2O4S — CID 54065441
2,2,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-2-[(2,2,2-trichloroacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54065441) has the molecular formula C12H12Cl6N2O4S and a molecular weight of 493.02 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-2-[(2,2,2-trichloroacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-2-[(2,2,2-trichloroacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54065441 |
| Molecular Formula | C12H12Cl6N2O4S |
| Molecular Weight | 493.02 g/mol |
| Exact Mass | 489.86 |
| IUPAC Name | 2,2,2-trichloroethyl (2S,5R)-3,3-dimethyl-7-oxo-2-[(2,2,2-trichloroacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2CC(=O)N2[C@@]1(NC(=O)C(Cl)(Cl)Cl)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H12Cl6N2O4S/c1-9(2)11(19-7(22)12(16,17)18,8(23)24-4-10(13,14)15)20-5(21)3-6(20)25-9/h6H,3-4H2,1-2H3,(H,19,22)/t6-,11+/m1/s1 |
| InChIKey | MCPPHDJOYDOIKZ-KBUNVGBDSA-N |
| XLogP | 3.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.02 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|