C12H14N2O4 — CID 54065906
4-ethyl-10-methyl-4,10-diazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene-3,5,9,11-tetrol (PubChem CID 54065906) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-ethyl-10-methyl-4,10-diazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene-3,5,9,11-tetrol.
| Compound Name | 4-ethyl-10-methyl-4,10-diazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene-3,5,9,11-tetrol |
|---|---|
| PubChem CID | 54065906 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-ethyl-10-methyl-4,10-diazatricyclo[6.3.0.02,6]undeca-1(11),2,5,8-tetraene-3,5,9,11-tetrol |
| SMILES | CCn1c(O)c2c(c1O)-c1c(c(O)n(C)c1O)C2 |
| InChI | InChI=1S/C12H14N2O4/c1-3-14-10(16)6-4-5-7(8(6)12(14)18)11(17)13(2)9(5)15/h15-18H,3-4H2,1-2H3 |
| InChIKey | MCYNCRHUMLADIF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |