About 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine
2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine (PubChem CID 54066096) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine |
| PubChem CID | 54066096 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine |
| SMILES | CN1CCN(C2=NCC=CN2)CC1 |
| InChI | InChI=1S/C9H16N4/c1-12-5-7-13(8-6-12)9-10-3-2-4-11-9/h2-3H,4-8H2,1H3,(H,10,11) |
| InChIKey | MDCGONJDCAYIEB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
The IUPAC name of 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine (CID 54066096) is 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine.
What is the SMILES notation for 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
The canonical SMILES for 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine is CN1CCN(C2=NCC=CN2)CC1.
What is the InChIKey of 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
The InChIKey is MDCGONJDCAYIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-12-5-7-13(8-6-12)9-10-3-2-4-11-9/h2-3H,4-8H2,1H3,(H,10,11).
What are the key properties of 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine?
2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine has a molecular weight of 180.25 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine is sourced from PubChem (CID 54066096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).