C16H20O4S — CID 54066153
(2R,7R)-7-(benzenesulfinylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane (PubChem CID 54066153) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is (2R,7R)-7-(benzenesulfinylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane.
| Compound Name | (2R,7R)-7-(benzenesulfinylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane |
|---|---|
| PubChem CID | 54066153 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (2R,7R)-7-(benzenesulfinylmethyl)-2,7-dimethyl-3,8,9-trioxatricyclo[4.3.1.02,4]decane |
| SMILES | C[C@@]12OC1CC1CC2OO[C@@]1(C)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c1-15(10-21(17)12-6-4-3-5-7-12)11-8-13-16(2,18-13)14(9-11)19-20-15/h3-7,11,13-14H,8-10H2,1-2H3/t11?,13?,14?,15-,16+,21?/m0/s1 |
| InChIKey | MDDLAIPIHZJABR-IMKLPTKASA-N |
| XLogP | 2.45 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|