About 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole
2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole (PubChem CID 54066283) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole |
| PubChem CID | 54066283 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole |
| SMILES | C1CNC(C2=NCCN2)C1 |
| InChI | InChI=1S/C7H13N3/c1-2-6(8-3-1)7-9-4-5-10-7/h6,8H,1-5H2,(H,9,10) |
| InChIKey | LLCCZYSNXVSMOH-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole (CID 54066283) is 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole is C1CNC(C2=NCCN2)C1.
What is the InChIKey of 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole?
The InChIKey is LLCCZYSNXVSMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-2-6(8-3-1)7-9-4-5-10-7/h6,8H,1-5H2,(H,9,10).
What are the key properties of 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole?
2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole has a molecular weight of 139.20 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-yl-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 54066283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).