C14H20N2O5 — CID 54066437
[(1S,2R,4S,6S,10S)-7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate (PubChem CID 54066437) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is [(1S,2R,4S,6S,10S)-7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate.
| Compound Name | [(1S,2R,4S,6S,10S)-7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 54066437 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(1S,2R,4S,6S,10S)-7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
| SMILES | CNC(=O)O[C@@H]1OC=C(C(=O)N(C)C)[C@H]2C[C@@H]3O[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C14H20N2O5/c1-14-9(21-14)5-7-8(11(17)16(3)4)6-19-12(10(7)14)20-13(18)15-2/h6-7,9-10,12H,5H2,1-4H3,(H,15,18)/t7-,9+,10-,12+,14+/m1/s1 |
| InChIKey | MDIDPHKTWFEPMI-RSUWGWRTSA-N |
| XLogP | 0.46 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|