C10H16NO2PS2 — CID 54066490
2-(3-ethylphenyl)-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethanamine (PubChem CID 54066490) has the molecular formula C10H16NO2PS2 and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethanamine.
| Compound Name | 2-(3-ethylphenyl)-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethanamine |
|---|---|
| PubChem CID | 54066490 |
| Molecular Formula | C10H16NO2PS2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-(3-ethylphenyl)-2-[hydroxy(sulfanyl)phosphinothioyl]oxyethanamine |
| SMILES | CCc1cccc(C(CN)OP(O)(=S)S)c1 |
| InChI | InChI=1S/C10H16NO2PS2/c1-2-8-4-3-5-9(6-8)10(7-11)13-14(12,15)16/h3-6,10H,2,7,11H2,1H3,(H2,12,15,16) |
| InChIKey | MDJIJFNJIKREJI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|