C28H27FO2 — CID 54066698
phenyl 4-fluoro-6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate (PubChem CID 54066698) has the molecular formula C28H27FO2 and a molecular weight of 414.52 g/mol. Its IUPAC name is phenyl 4-fluoro-6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate.
| Compound Name | phenyl 4-fluoro-6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54066698 |
| Molecular Formula | C28H27FO2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | phenyl 4-fluoro-6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate |
| SMILES | CC1=C(C=Cc2ccc3cc(C(=O)Oc4ccccc4)cc(F)c3c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H27FO2/c1-19-8-7-15-28(2,3)25(19)14-12-20-11-13-21-17-22(18-26(29)24(21)16-20)27(30)31-23-9-5-4-6-10-23/h4-6,9-14,16-18H,7-8,15H2,1-3H3 |
| InChIKey | MDMXKGQYOVHEGT-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|