C19H19NO4 — CID 54067477
ethyl 4-benzyl-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-1-carboxylate (PubChem CID 54067477) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl 4-benzyl-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-1-carboxylate.
| Compound Name | ethyl 4-benzyl-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-1-carboxylate |
|---|---|
| PubChem CID | 54067477 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl 4-benzyl-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-1-carboxylate |
| SMILES | CCOC(=O)C12C=CC(C1)c1c2c(O)n(Cc2ccccc2)c1O |
| InChI | InChI=1S/C19H19NO4/c1-2-24-18(23)19-9-8-13(10-19)14-15(19)17(22)20(16(14)21)11-12-6-4-3-5-7-12/h3-9,13,21-22H,2,10-11H2,1H3 |
| InChIKey | MEANBTTWQNTRMS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|