About 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol
2,7-dimethylocta-2,6-dien-4-yne-1,8-diol (PubChem CID 54067481) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol.
Molecular Properties
| Compound Name | 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol |
| PubChem CID | 54067481 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol |
| SMILES | CC(=CC#CC=C(C)CO)CO |
| InChI | InChI=1S/C10H14O2/c1-9(7-11)5-3-4-6-10(2)8-12/h5-6,11-12H,7-8H2,1-2H3 |
| InChIKey | MEAONJBNSODGKA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol?
The IUPAC name of 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol (CID 54067481) is 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol.
What is the SMILES notation for 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol?
The canonical SMILES for 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol is CC(=CC#CC=C(C)CO)CO.
What is the InChIKey of 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol?
The InChIKey is MEAONJBNSODGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-9(7-11)5-3-4-6-10(2)8-12/h5-6,11-12H,7-8H2,1-2H3.
What are the key properties of 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol?
2,7-dimethylocta-2,6-dien-4-yne-1,8-diol has a molecular weight of 166.22 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylocta-2,6-dien-4-yne-1,8-diol is sourced from PubChem (CID 54067481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).