About 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene
4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene (PubChem CID 54068249) has the molecular formula C14H18S
and a molecular weight of 218.36 g/mol. Its IUPAC name is 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene.
Molecular Properties
| Compound Name | 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene |
| PubChem CID | 54068249 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene |
| SMILES | C=C(C)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C14H18S/c1-10(2)11-5-6-13-12(9-11)14(3,4)7-8-15-13/h5-6,9H,1,7-8H2,2-4H3 |
| InChIKey | MEOKWXPGNSKNTM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene?
The IUPAC name of 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene (CID 54068249) is 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene.
What is the SMILES notation for 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene?
The canonical SMILES for 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene is C=C(C)c1ccc2c(c1)C(C)(C)CCS2.
What is the InChIKey of 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene?
The InChIKey is MEOKWXPGNSKNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18S/c1-10(2)11-5-6-13-12(9-11)14(3,4)7-8-15-13/h5-6,9H,1,7-8H2,2-4H3.
What are the key properties of 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene?
4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene has a molecular weight of 218.36 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-6-prop-1-en-2-yl-2,3-dihydrothiochromene is sourced from PubChem (CID 54068249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).