C14H28N3O4PS2 — CID 54068505
methyl N-[[tert-butyl-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate (PubChem CID 54068505) has the molecular formula C14H28N3O4PS2 and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl N-[[tert-butyl-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl N-[[tert-butyl-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 54068505 |
| Molecular Formula | C14H28N3O4PS2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | methyl N-[[tert-butyl-(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
| SMILES | CSC(C)=NOC(=O)N(C)SN(P1OCC(C)(C)CO1)C(C)(C)C |
| InChI | InChI=1S/C14H28N3O4PS2/c1-11(23-8)15-21-12(18)16(7)24-17(13(2,3)4)22-19-9-14(5,6)10-20-22/h9-10H2,1-8H3 |
| InChIKey | METCBPIOYIMIBR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|