C24H29N3O5S — CID 54068884
4-nitroso-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid (PubChem CID 54068884) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-nitroso-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid.
| Compound Name | 4-nitroso-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid |
|---|---|
| PubChem CID | 54068884 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-nitroso-4-(6,7,8,9-tetrahydrodibenzothiophen-3-yl)-2-[2-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)ethyl]butanoic acid |
| SMILES | CN1C(=O)N(CCC(CC(N=O)c2ccc3c4c(sc3c2)CCCC4)C(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C24H29N3O5S/c1-24(2)22(30)27(23(31)26(24)3)11-10-15(21(28)29)12-18(25-32)14-8-9-17-16-6-4-5-7-19(16)33-20(17)13-14/h8-9,13,15,18H,4-7,10-12H2,1-3H3,(H,28,29) |
| InChIKey | MEZJCOQJPKVGCC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|