C21H18N6 — CID 54069196
2-N,6-diphenyl-4-N-(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 54069196) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-N,6-diphenyl-4-N-(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,6-diphenyl-4-N-(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 54069196 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-N,6-diphenyl-4-N-(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | c1ccc(Nc2nc(NCc3ccccn3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H18N6/c1-3-9-16(10-4-1)19-25-20(23-15-18-13-7-8-14-22-18)27-21(26-19)24-17-11-5-2-6-12-17/h1-14H,15H2,(H2,23,24,25,26,27) |
| InChIKey | MFENCVQKCSNKFH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |