C19H28F2 — CID 54069251
(8S,9R,11S,13S,14S)-11-(difluoromethyl)-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 54069251) has the molecular formula C19H28F2 and a molecular weight of 294.43 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S)-11-(difluoromethyl)-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,11S,13S,14S)-11-(difluoromethyl)-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 54069251 |
| Molecular Formula | C19H28F2 |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (8S,9R,11S,13S,14S)-11-(difluoromethyl)-13-methyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=C(CCCC3)[C@H]1C(C(F)F)C2 |
| InChI | InChI=1S/C19H28F2/c1-19-10-4-7-16(19)14-9-8-12-5-2-3-6-13(12)17(14)15(11-19)18(20)21/h14-18H,2-11H2,1H3/t14-,15?,16-,17+,19-/m0/s1 |
| InChIKey | MFFLVMPKOIFLEO-HFFGGIOOSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|