About [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate
[difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate (PubChem CID 54069480) has the molecular formula C14H8F5NO2
and a molecular weight of 317.21 g/mol. Its IUPAC name is [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate.
Molecular Properties
| Compound Name | [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate |
| PubChem CID | 54069480 |
| Molecular Formula | C14H8F5NO2 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OC(F)(F)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H8F5NO2/c15-10-6-5-9(11(16)12(10)17)14(18,19)22-13(21)7-1-3-8(20)4-2-7/h1-6H,20H2 |
| InChIKey | MFJJUNGZWKZFSH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate?
The IUPAC name of [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate (CID 54069480) is [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate.
What is the SMILES notation for [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate?
The canonical SMILES for [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate is Nc1ccc(C(=O)OC(F)(F)c2ccc(F)c(F)c2F)cc1.
What is the InChIKey of [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate?
The InChIKey is MFJJUNGZWKZFSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F5NO2/c15-10-6-5-9(11(16)12(10)17)14(18,19)22-13(21)7-1-3-8(20)4-2-7/h1-6H,20H2.
What are the key properties of [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate?
[difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate has a molecular weight of 317.21 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [difluoro-(2,3,4-trifluorophenyl)methyl] 4-aminobenzoate is sourced from PubChem (CID 54069480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).