C6H6Cl4F4O — CID 54069825
1,1-dichloro-3-(3,3-dichloro-2,2-difluoropropoxy)-2,2-difluoropropane (PubChem CID 54069825) has the molecular formula C6H6Cl4F4O and a molecular weight of 311.92 g/mol. Its IUPAC name is 1,1-dichloro-3-(3,3-dichloro-2,2-difluoropropoxy)-2,2-difluoropropane.
| Compound Name | 1,1-dichloro-3-(3,3-dichloro-2,2-difluoropropoxy)-2,2-difluoropropane |
|---|---|
| PubChem CID | 54069825 |
| Molecular Formula | C6H6Cl4F4O |
| Molecular Weight | 311.92 g/mol |
| Exact Mass | 309.91 |
| IUPAC Name | 1,1-dichloro-3-(3,3-dichloro-2,2-difluoropropoxy)-2,2-difluoropropane |
| SMILES | FC(F)(COCC(F)(F)C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C6H6Cl4F4O/c7-3(8)5(11,12)1-15-2-6(13,14)4(9)10/h3-4H,1-2H2 |
| InChIKey | MFQDDLJUJRTHFM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|