C30H50O6 — CID 54070235
butyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4,4-dimethyloct-2-enylidene)cyclopentyl]heptanoate (PubChem CID 54070235) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is butyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4,4-dimethyloct-2-enylidene)cyclopentyl]heptanoate.
| Compound Name | butyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4,4-dimethyloct-2-enylidene)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54070235 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | butyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4,4-dimethyloct-2-enylidene)cyclopentyl]heptanoate |
| SMILES | CCCCOC(=O)CCCCCC[C@@H]1C(=CC=C(OC(C)=O)C(C)(C)CCCC)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H50O6/c1-7-9-21-30(5,6)28(36-24(4)32)20-18-25-17-19-27(35-23(3)31)26(25)15-13-11-12-14-16-29(33)34-22-10-8-2/h18,20,26-27H,7-17,19,21-22H2,1-6H3/t26-,27-/m1/s1 |
| InChIKey | MFXSYLPQGUYWHQ-KAYWLYCHSA-N |
| XLogP | 7.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|