About 3-aminosulfanylpropane-1,1-diol
3-aminosulfanylpropane-1,1-diol (PubChem CID 54070357) has the molecular formula C3H9NO2S
and a molecular weight of 123.18 g/mol. Its IUPAC name is 3-aminosulfanylpropane-1,1-diol.
Molecular Properties
| Compound Name | 3-aminosulfanylpropane-1,1-diol |
| PubChem CID | 54070357 |
| Molecular Formula | C3H9NO2S |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 3-aminosulfanylpropane-1,1-diol |
| SMILES | NSCCC(O)O |
| InChI | InChI=1S/C3H9NO2S/c4-7-2-1-3(5)6/h3,5-6H,1-2,4H2 |
| InChIKey | MFZPOTFXRWDEBY-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-aminosulfanylpropane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminosulfanylpropane-1,1-diol?
The IUPAC name of 3-aminosulfanylpropane-1,1-diol (CID 54070357) is 3-aminosulfanylpropane-1,1-diol.
What is the SMILES notation for 3-aminosulfanylpropane-1,1-diol?
The canonical SMILES for 3-aminosulfanylpropane-1,1-diol is NSCCC(O)O.
What is the InChIKey of 3-aminosulfanylpropane-1,1-diol?
The InChIKey is MFZPOTFXRWDEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2S/c4-7-2-1-3(5)6/h3,5-6H,1-2,4H2.
What are the key properties of 3-aminosulfanylpropane-1,1-diol?
3-aminosulfanylpropane-1,1-diol has a molecular weight of 123.18 g/mol, XLogP of -0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminosulfanylpropane-1,1-diol is sourced from PubChem (CID 54070357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).